C27H28N6O4 — CID 3983790
N-[2-(4-ethoxyphenyl)-6-methylbenzotriazol-5-yl]-3-nitro-4-piperidin-1-ylbenzamide (PubChem CID 3983790) has the molecular formula C27H28N6O4 and a molecular weight of 500.56 g/mol. Its IUPAC name is N-[2-(4-ethoxyphenyl)-6-methylbenzotriazol-5-yl]-3-nitro-4-piperidin-1-ylbenzamide.
| Compound Name | N-[2-(4-ethoxyphenyl)-6-methylbenzotriazol-5-yl]-3-nitro-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 3983790 |
| Molecular Formula | C27H28N6O4 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | N-[2-(4-ethoxyphenyl)-6-methylbenzotriazol-5-yl]-3-nitro-4-piperidin-1-ylbenzamide |
| SMILES | CCOc1ccc(-n2nc3cc(C)c(NC(=O)c4ccc(N5CCCCC5)c([N+](=O)[O-])c4)cc3n2)cc1 |
| InChI | InChI=1S/C27H28N6O4/c1-3-37-21-10-8-20(9-11-21)32-29-23-15-18(2)22(17-24(23)30-32)28-27(34)19-7-12-25(26(16-19)33(35)36)31-13-5-4-6-14-31/h7-12,15-17H,3-6,13-14H2,1-2H3,(H,28,34) |
| InChIKey | VVJGEBHEAYAXLF-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 115.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|