About 5-bromo-N-[1-(1,3-dioxoisoindol-2-yl)propan-2-ylideneamino]-2-hydroxybenzamide
5-bromo-N-[1-(1,3-dioxoisoindol-2-yl)propan-2-ylideneamino]-2-hydroxybenzamide (PubChem CID 3984145) has the molecular formula C18H14BrN3O4
and a molecular weight of 416.23 g/mol. Its IUPAC name is 5-bromo-N-[1-(1,3-dioxoisoindol-2-yl)propan-2-ylideneamino]-2-hydroxybenzamide.
Molecular Properties
| Compound Name | 5-bromo-N-[1-(1,3-dioxoisoindol-2-yl)propan-2-ylideneamino]-2-hydroxybenzamide |
| PubChem CID | 3984145 |
| Molecular Formula | C18H14BrN3O4 |
| Molecular Weight | 416.23 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | 5-bromo-N-[1-(1,3-dioxoisoindol-2-yl)propan-2-ylideneamino]-2-hydroxybenzamide |
| SMILES | CC(CN1C(=O)c2ccccc2C1=O)=NNC(=O)c1cc(Br)ccc1O |
| InChI | InChI=1S/C18H14BrN3O4/c1-10(20-21-16(24)14-8-11(19)6-7-15(14)23)9-22-17(25)12-4-2-3-5-13(12)18(22)26/h2-8,23H,9H2,1H3,(H,21,24) |
| InChIKey | NEUSLJMCQLSNDT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.23 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-N-[1-(1,3-dioxoisoindol-2-yl)propan-2-ylideneamino]-2-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-[1-(1,3-dioxoisoindol-2-yl)propan-2-ylideneamino]-2-hydroxybenzamide?
The IUPAC name of 5-bromo-N-[1-(1,3-dioxoisoindol-2-yl)propan-2-ylideneamino]-2-hydroxybenzamide (CID 3984145) is 5-bromo-N-[1-(1,3-dioxoisoindol-2-yl)propan-2-ylideneamino]-2-hydroxybenzamide.
What is the SMILES notation for 5-bromo-N-[1-(1,3-dioxoisoindol-2-yl)propan-2-ylideneamino]-2-hydroxybenzamide?
The canonical SMILES for 5-bromo-N-[1-(1,3-dioxoisoindol-2-yl)propan-2-ylideneamino]-2-hydroxybenzamide is CC(CN1C(=O)c2ccccc2C1=O)=NNC(=O)c1cc(Br)ccc1O.
What is the InChIKey of 5-bromo-N-[1-(1,3-dioxoisoindol-2-yl)propan-2-ylideneamino]-2-hydroxybenzamide?
The InChIKey is NEUSLJMCQLSNDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14BrN3O4/c1-10(20-21-16(24)14-8-11(19)6-7-15(14)23)9-22-17(25)12-4-2-3-5-13(12)18(22)26/h2-8,23H,9H2,1H3,(H,21,24).
What are the key properties of 5-bromo-N-[1-(1,3-dioxoisoindol-2-yl)propan-2-ylideneamino]-2-hydroxybenzamide?
5-bromo-N-[1-(1,3-dioxoisoindol-2-yl)propan-2-ylideneamino]-2-hydroxybenzamide has a molecular weight of 416.23 g/mol, XLogP of 2.56, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-[1-(1,3-dioxoisoindol-2-yl)propan-2-ylideneamino]-2-hydroxybenzamide is sourced from PubChem (CID 3984145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).