C23H35N7O2 — CID 39847827
4-N-(4-methoxyphenyl)-6-morpholin-4-yl-2-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 39847827) has the molecular formula C23H35N7O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is 4-N-(4-methoxyphenyl)-6-morpholin-4-yl-2-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-(4-methoxyphenyl)-6-morpholin-4-yl-2-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 39847827 |
| Molecular Formula | C23H35N7O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.29 |
| IUPAC Name | 4-N-(4-methoxyphenyl)-6-morpholin-4-yl-2-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccc(Nc2nc(NC3CC(C)(C)NC(C)(C)C3)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C23H35N7O2/c1-22(2)14-17(15-23(3,4)29-22)25-20-26-19(24-16-6-8-18(31-5)9-7-16)27-21(28-20)30-10-12-32-13-11-30/h6-9,17,29H,10-15H2,1-5H3,(H2,24,25,26,27,28) |
| InChIKey | JJBLPLBTXJEUNW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 96.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |