C17H20N4O4S — CID 3984924
1-methyl-6-oxo-N-(3-piperidin-1-ylsulfonylphenyl)pyridazine-3-carboxamide (PubChem CID 3984924) has the molecular formula C17H20N4O4S and a molecular weight of 376.44 g/mol. Its IUPAC name is 1-methyl-6-oxo-N-(3-piperidin-1-ylsulfonylphenyl)pyridazine-3-carboxamide.
| Compound Name | 1-methyl-6-oxo-N-(3-piperidin-1-ylsulfonylphenyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 3984924 |
| Molecular Formula | C17H20N4O4S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 1-methyl-6-oxo-N-(3-piperidin-1-ylsulfonylphenyl)pyridazine-3-carboxamide |
| SMILES | Cn1nc(C(=O)Nc2cccc(S(=O)(=O)N3CCCCC3)c2)ccc1=O |
| InChI | InChI=1S/C17H20N4O4S/c1-20-16(22)9-8-15(19-20)17(23)18-13-6-5-7-14(12-13)26(24,25)21-10-3-2-4-11-21/h5-9,12H,2-4,10-11H2,1H3,(H,18,23) |
| InChIKey | WIZQUZDJLFTXPL-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |