C20H27N5O5S — CID 4324298
N-[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]-1-methyl-6-oxopyridazine-3-carboxamide (PubChem CID 4324298) has the molecular formula C20H27N5O5S and a molecular weight of 449.50 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]-1-methyl-6-oxopyridazine-3-carboxamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]-1-methyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 4324298 |
| Molecular Formula | C20H27N5O5S |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]-1-methyl-6-oxopyridazine-3-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)C1=CC(=C(C=C1)N2CCOCC2)NC(=O)C3=NN(C(=O)C=C3)C |
| InChI | InChI=1S/C20H27N5O5S/c1-4-25(5-2)31(28,29)15-6-8-18(24-10-12-30-13-11-24)17(14-15)21-20(27)16-7-9-19(26)23(3)22-16/h6-9,14H,4-5,10-13H2,1-3H3,(H,21,27) |
| InChIKey | XRHNKXIOHOKKES-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | 827 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |