C17H12F2N2O2 — CID 39849554
N-(3,5-difluorophenyl)-2-methyl-4-oxo-1H-quinoline-6-carboxamide (PubChem CID 39849554) has the molecular formula C17H12F2N2O2 and a molecular weight of 314.29 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-2-methyl-4-oxo-1H-quinoline-6-carboxamide.
| Compound Name | N-(3,5-difluorophenyl)-2-methyl-4-oxo-1H-quinoline-6-carboxamide |
|---|---|
| PubChem CID | 39849554 |
| Molecular Formula | C17H12F2N2O2 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | N-(3,5-difluorophenyl)-2-methyl-4-oxo-1H-quinoline-6-carboxamide |
| SMILES | Cc1cc(=O)c2cc(C(=O)Nc3cc(F)cc(F)c3)ccc2[nH]1 |
| InChI | InChI=1S/C17H12F2N2O2/c1-9-4-16(22)14-5-10(2-3-15(14)20-9)17(23)21-13-7-11(18)6-12(19)8-13/h2-8H,1H3,(H,20,22)(H,21,23) |
| InChIKey | PJAVVINQQIHFTL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |