C23H16ClF2N3O4 — CID 39854105
2-chloro-N-[3-[5-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-3-yl]phenyl]-4,5-difluorobenzamide (PubChem CID 39854105) has the molecular formula C23H16ClF2N3O4 and a molecular weight of 471.85 g/mol. Its IUPAC name is 2-chloro-N-[3-[5-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-3-yl]phenyl]-4,5-difluorobenzamide.
| Compound Name | 2-chloro-N-[3-[5-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-3-yl]phenyl]-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 39854105 |
| Molecular Formula | C23H16ClF2N3O4 |
| Molecular Weight | 471.85 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | 2-chloro-N-[3-[5-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-3-yl]phenyl]-4,5-difluorobenzamide |
| SMILES | COc1ccc(-c2nc(-c3cccc(NC(=O)c4cc(F)c(F)cc4Cl)c3)no2)cc1OC |
| InChI | InChI=1S/C23H16ClF2N3O4/c1-31-19-7-6-13(9-20(19)32-2)23-28-21(29-33-23)12-4-3-5-14(8-12)27-22(30)15-10-17(25)18(26)11-16(15)24/h3-11H,1-2H3,(H,27,30) |
| InChIKey | DCIWEWUECOUOPZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.85 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|