C19H23FN4O — CID 39855125
(1-cyclopentylpyrazol-3-yl)-[4-(4-fluorophenyl)piperazin-1-yl]methanone (PubChem CID 39855125) has the molecular formula C19H23FN4O and a molecular weight of 342.42 g/mol. Its IUPAC name is (1-cyclopentylpyrazol-3-yl)-[4-(4-fluorophenyl)piperazin-1-yl]methanone.
| Compound Name | (1-cyclopentylpyrazol-3-yl)-[4-(4-fluorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 39855125 |
| Molecular Formula | C19H23FN4O |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | (1-cyclopentylpyrazol-3-yl)-[4-(4-fluorophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccn(C2CCCC2)n1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H23FN4O/c20-15-5-7-16(8-6-15)22-11-13-23(14-12-22)19(25)18-9-10-24(21-18)17-3-1-2-4-17/h5-10,17H,1-4,11-14H2 |
| InChIKey | LCPKUBVYXCQGRH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |