C17H28ClN5O — CID 120997672
(1-cyclopentylpyrazol-3-yl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone;hydrochloride (PubChem CID 120997672) has the molecular formula C17H28ClN5O and a molecular weight of 353.90 g/mol. Its IUPAC name is (1-cyclopentylpyrazol-3-yl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone;hydrochloride.
| Compound Name | (1-cyclopentylpyrazol-3-yl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120997672 |
| Molecular Formula | C17H28ClN5O |
| Molecular Weight | 353.90 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | (1-cyclopentylpyrazol-3-yl)-(3-piperazin-1-ylpyrrolidin-1-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1ccn(C2CCCC2)n1)N1CCC(N2CCNCC2)C1 |
| InChI | InChI=1S/C17H27N5O.ClH/c23-17(16-6-10-22(19-16)14-3-1-2-4-14)21-9-5-15(13-21)20-11-7-18-8-12-20;/h6,10,14-15,18H,1-5,7-9,11-13H2;1H |
| InChIKey | ZMAQLXZZHUBFMZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.90 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |