About 2-[(2,4-dimethylphenoxy)methyl]-5-(2-thiophen-2-ylethylamino)-1,3-oxazole-4-carbonitrile
2-[(2,4-dimethylphenoxy)methyl]-5-(2-thiophen-2-ylethylamino)-1,3-oxazole-4-carbonitrile (PubChem CID 39868405) has the molecular formula C19H19N3O2S
and a molecular weight of 353.45 g/mol. Its IUPAC name is 2-[(2,4-dimethylphenoxy)methyl]-5-(2-thiophen-2-ylethylamino)-1,3-oxazole-4-carbonitrile.
Molecular Properties
| Compound Name | 2-[(2,4-dimethylphenoxy)methyl]-5-(2-thiophen-2-ylethylamino)-1,3-oxazole-4-carbonitrile |
| PubChem CID | 39868405 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 2-[(2,4-dimethylphenoxy)methyl]-5-(2-thiophen-2-ylethylamino)-1,3-oxazole-4-carbonitrile |
| SMILES | Cc1ccc(OCc2nc(C#N)c(NCCc3cccs3)o2)c(C)c1 |
| InChI | InChI=1S/C19H19N3O2S/c1-13-5-6-17(14(2)10-13)23-12-18-22-16(11-20)19(24-18)21-8-7-15-4-3-9-25-15/h3-6,9-10,21H,7-8,12H2,1-2H3 |
| InChIKey | OQVLAHHQBCVETL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(2,4-dimethylphenoxy)methyl]-5-(2-thiophen-2-ylethylamino)-1,3-oxazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,4-dimethylphenoxy)methyl]-5-(2-thiophen-2-ylethylamino)-1,3-oxazole-4-carbonitrile?
The IUPAC name of 2-[(2,4-dimethylphenoxy)methyl]-5-(2-thiophen-2-ylethylamino)-1,3-oxazole-4-carbonitrile (CID 39868405) is 2-[(2,4-dimethylphenoxy)methyl]-5-(2-thiophen-2-ylethylamino)-1,3-oxazole-4-carbonitrile.
What is the SMILES notation for 2-[(2,4-dimethylphenoxy)methyl]-5-(2-thiophen-2-ylethylamino)-1,3-oxazole-4-carbonitrile?
The canonical SMILES for 2-[(2,4-dimethylphenoxy)methyl]-5-(2-thiophen-2-ylethylamino)-1,3-oxazole-4-carbonitrile is Cc1ccc(OCc2nc(C#N)c(NCCc3cccs3)o2)c(C)c1.
What is the InChIKey of 2-[(2,4-dimethylphenoxy)methyl]-5-(2-thiophen-2-ylethylamino)-1,3-oxazole-4-carbonitrile?
The InChIKey is OQVLAHHQBCVETL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O2S/c1-13-5-6-17(14(2)10-13)23-12-18-22-16(11-20)19(24-18)21-8-7-15-4-3-9-25-15/h3-6,9-10,21H,7-8,12H2,1-2H3.
What are the key properties of 2-[(2,4-dimethylphenoxy)methyl]-5-(2-thiophen-2-ylethylamino)-1,3-oxazole-4-carbonitrile?
2-[(2,4-dimethylphenoxy)methyl]-5-(2-thiophen-2-ylethylamino)-1,3-oxazole-4-carbonitrile has a molecular weight of 353.45 g/mol, XLogP of 4.46, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-dimethylphenoxy)methyl]-5-(2-thiophen-2-ylethylamino)-1,3-oxazole-4-carbonitrile is sourced from PubChem (CID 39868405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).