C14H11Cl2N3O3S2 — CID 39878830
N-[(3aS,6aR)-3-(2,6-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-cyanoacetamide (PubChem CID 39878830) has the molecular formula C14H11Cl2N3O3S2 and a molecular weight of 404.30 g/mol. Its IUPAC name is N-[(3aS,6aR)-3-(2,6-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-cyanoacetamide.
| Compound Name | N-[(3aS,6aR)-3-(2,6-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-cyanoacetamide |
|---|---|
| PubChem CID | 39878830 |
| Molecular Formula | C14H11Cl2N3O3S2 |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 402.96 |
| IUPAC Name | N-[(3aS,6aR)-3-(2,6-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-cyanoacetamide |
| SMILES | N#CCC(=O)/N=C1\S[C@H]2CS(=O)(=O)C[C@@H]2N1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H11Cl2N3O3S2/c15-8-2-1-3-9(16)13(8)19-10-6-24(21,22)7-11(10)23-14(19)18-12(20)4-5-17/h1-3,10-11H,4,6-7H2/b18-14-/t10-,11-/m0/s1 |
| InChIKey | VSLKGFCGSYPKNR-FMVACOBOSA-N |
| XLogP | 2.51 |
| TPSA | 90.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|