C15H11ClF3N3O3S2 — CID 41091791
N-[(3aR,6aR)-3-[4-chloro-3-(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-cyanoacetamide (PubChem CID 41091791) has the molecular formula C15H11ClF3N3O3S2 and a molecular weight of 437.85 g/mol. Its IUPAC name is N-[(3aR,6aR)-3-[4-chloro-3-(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-cyanoacetamide.
| Compound Name | N-[(3aR,6aR)-3-[4-chloro-3-(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-cyanoacetamide |
|---|---|
| PubChem CID | 41091791 |
| Molecular Formula | C15H11ClF3N3O3S2 |
| Molecular Weight | 437.85 g/mol |
| Exact Mass | 436.99 |
| IUPAC Name | N-[(3aR,6aR)-3-[4-chloro-3-(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-cyanoacetamide |
| SMILES | N#CCC(=O)/N=C1\S[C@H]2CS(=O)(=O)C[C@H]2N1c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H11ClF3N3O3S2/c16-10-2-1-8(5-9(10)15(17,18)19)22-11-6-27(24,25)7-12(11)26-14(22)21-13(23)3-4-20/h1-2,5,11-12H,3,6-7H2/b21-14-/t11-,12+/m1/s1 |
| InChIKey | NRQXCCORXAWBTA-UULIHBGTSA-N |
| XLogP | 2.87 |
| TPSA | 90.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.85 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|