C15H12F3N3O4S2 — CID 41075328
N-[(3aR,6aR)-5,5-dioxo-3-[4-(trifluoromethoxy)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-cyanoacetamide (PubChem CID 41075328) has the molecular formula C15H12F3N3O4S2 and a molecular weight of 419.41 g/mol. Its IUPAC name is N-[(3aR,6aR)-5,5-dioxo-3-[4-(trifluoromethoxy)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-cyanoacetamide.
| Compound Name | N-[(3aR,6aR)-5,5-dioxo-3-[4-(trifluoromethoxy)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-cyanoacetamide |
|---|---|
| PubChem CID | 41075328 |
| Molecular Formula | C15H12F3N3O4S2 |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.02 |
| IUPAC Name | N-[(3aR,6aR)-5,5-dioxo-3-[4-(trifluoromethoxy)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-cyanoacetamide |
| SMILES | N#CCC(=O)/N=C1\S[C@H]2CS(=O)(=O)C[C@H]2N1c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H12F3N3O4S2/c16-15(17,18)25-10-3-1-9(2-4-10)21-11-7-27(23,24)8-12(11)26-14(21)20-13(22)5-6-19/h1-4,11-12H,5,7-8H2/b20-14-/t11-,12+/m1/s1 |
| InChIKey | CPHOCKDEGAQCIH-YDGRJCAWSA-N |
| XLogP | 2.10 |
| TPSA | 99.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|