C21H19F3N2O4S2 — CID 39740924
N-[(3aS,6aR)-5,5-dioxo-3-[4-(trifluoromethoxy)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-phenylpropanamide (PubChem CID 39740924) has the molecular formula C21H19F3N2O4S2 and a molecular weight of 484.52 g/mol. Its IUPAC name is N-[(3aS,6aR)-5,5-dioxo-3-[4-(trifluoromethoxy)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-phenylpropanamide.
| Compound Name | N-[(3aS,6aR)-5,5-dioxo-3-[4-(trifluoromethoxy)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-phenylpropanamide |
|---|---|
| PubChem CID | 39740924 |
| Molecular Formula | C21H19F3N2O4S2 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | N-[(3aS,6aR)-5,5-dioxo-3-[4-(trifluoromethoxy)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)/N=C1\S[C@H]2CS(=O)(=O)C[C@@H]2N1c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H19F3N2O4S2/c22-21(23,24)30-16-9-7-15(8-10-16)26-17-12-32(28,29)13-18(17)31-20(26)25-19(27)11-6-14-4-2-1-3-5-14/h1-5,7-10,17-18H,6,11-13H2/b25-20-/t17-,18-/m0/s1 |
| InChIKey | MCKOTOJZAOWBNE-RJZAFKGISA-N |
| XLogP | 3.82 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|