C16H15F3N2O7S2 — CID 39740906
2-[2-[[(3aR,6aR)-5,5-dioxo-3-[4-(trifluoromethoxy)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethoxy]acetic acid (PubChem CID 39740906) has the molecular formula C16H15F3N2O7S2 and a molecular weight of 468.43 g/mol. Its IUPAC name is 2-[2-[[(3aR,6aR)-5,5-dioxo-3-[4-(trifluoromethoxy)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[[(3aR,6aR)-5,5-dioxo-3-[4-(trifluoromethoxy)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 39740906 |
| Molecular Formula | C16H15F3N2O7S2 |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 468.03 |
| IUPAC Name | 2-[2-[[(3aR,6aR)-5,5-dioxo-3-[4-(trifluoromethoxy)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethoxy]acetic acid |
| SMILES | O=C(O)COCC(=O)/N=C1\S[C@H]2CS(=O)(=O)C[C@H]2N1c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H15F3N2O7S2/c17-16(18,19)28-10-3-1-9(2-4-10)21-11-7-30(25,26)8-12(11)29-15(21)20-13(22)5-27-6-14(23)24/h1-4,11-12H,5-8H2,(H,23,24)/b20-15-/t11-,12+/m1/s1 |
| InChIKey | QHECOOWOUBYYIU-FMUFKYDXSA-N |
| XLogP | 1.29 |
| TPSA | 122.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|