C17H14F6N2O6S2 — CID 98191617
2-[2-[[(3aS,6aS)-3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethoxy]acetic acid (PubChem CID 98191617) has the molecular formula C17H14F6N2O6S2 and a molecular weight of 520.43 g/mol. Its IUPAC name is 2-[2-[[(3aS,6aS)-3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[[(3aS,6aS)-3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 98191617 |
| Molecular Formula | C17H14F6N2O6S2 |
| Molecular Weight | 520.43 g/mol |
| Exact Mass | 520.02 |
| IUPAC Name | 2-[2-[[(3aS,6aS)-3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-2-oxoethoxy]acetic acid |
| SMILES | O=C(O)COCC(=O)/N=C1\S[C@@H]2CS(=O)(=O)C[C@@H]2N1c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H14F6N2O6S2/c18-16(19,20)8-1-9(17(21,22)23)3-10(2-8)25-11-6-33(29,30)7-12(11)32-15(25)24-13(26)4-31-5-14(27)28/h1-3,11-12H,4-7H2,(H,27,28)/b24-15-/t11-,12+/m0/s1 |
| InChIKey | DMOSJUMDMUXBJZ-DLROOJHCSA-N |
| XLogP | 2.43 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|