C18H16F6N2O5S2 — CID 98153764
5-[[(3aR,6aS)-3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-5-oxopentanoic acid (PubChem CID 98153764) has the molecular formula C18H16F6N2O5S2 and a molecular weight of 518.46 g/mol. Its IUPAC name is 5-[[(3aR,6aS)-3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-5-oxopentanoic acid.
| Compound Name | 5-[[(3aR,6aS)-3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 98153764 |
| Molecular Formula | C18H16F6N2O5S2 |
| Molecular Weight | 518.46 g/mol |
| Exact Mass | 518.04 |
| IUPAC Name | 5-[[(3aR,6aS)-3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)/N=C1\S[C@@H]2CS(=O)(=O)C[C@H]2N1c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H16F6N2O5S2/c19-17(20,21)9-4-10(18(22,23)24)6-11(5-9)26-12-7-33(30,31)8-13(12)32-16(26)25-14(27)2-1-3-15(28)29/h4-6,12-13H,1-3,7-8H2,(H,28,29)/b25-16-/t12-,13-/m1/s1 |
| InChIKey | MGQKUUKFEHEFKE-OQVVZTPMSA-N |
| XLogP | 3.58 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|