C21H16F6N2O4S2 — CID 98191620
N-[(3aR,6aS)-3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-phenoxyacetamide (PubChem CID 98191620) has the molecular formula C21H16F6N2O4S2 and a molecular weight of 538.49 g/mol. Its IUPAC name is N-[(3aR,6aS)-3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-phenoxyacetamide.
| Compound Name | N-[(3aR,6aS)-3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 98191620 |
| Molecular Formula | C21H16F6N2O4S2 |
| Molecular Weight | 538.49 g/mol |
| Exact Mass | 538.05 |
| IUPAC Name | N-[(3aR,6aS)-3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)/N=C1\S[C@@H]2CS(=O)(=O)C[C@H]2N1c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H16F6N2O4S2/c22-20(23,24)12-6-13(21(25,26)27)8-14(7-12)29-16-10-35(31,32)11-17(16)34-19(29)28-18(30)9-33-15-4-2-1-3-5-15/h1-8,16-17H,9-11H2/b28-19-/t16-,17-/m1/s1 |
| InChIKey | SCQARKXMIHMBAO-HWTQCOGNSA-N |
| XLogP | 4.40 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|