C18H18F6N2O3S2 — CID 39739691
N-[(3aR,6aR)-3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-methylbutanamide (PubChem CID 39739691) has the molecular formula C18H18F6N2O3S2 and a molecular weight of 488.48 g/mol. Its IUPAC name is N-[(3aR,6aR)-3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-methylbutanamide.
| Compound Name | N-[(3aR,6aR)-3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-methylbutanamide |
|---|---|
| PubChem CID | 39739691 |
| Molecular Formula | C18H18F6N2O3S2 |
| Molecular Weight | 488.48 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | N-[(3aR,6aR)-3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)/N=C1\S[C@H]2CS(=O)(=O)C[C@H]2N1c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H18F6N2O3S2/c1-9(2)3-15(27)25-16-26(13-7-31(28,29)8-14(13)30-16)12-5-10(17(19,20)21)4-11(6-12)18(22,23)24/h4-6,9,13-14H,3,7-8H2,1-2H3/b25-16-/t13-,14+/m1/s1 |
| InChIKey | VLGJAYXLCRBPOW-BCYRREQOSA-N |
| XLogP | 4.37 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|