C22H18F6N2O4S2 — CID 98191611
N-[(3aS,6aR)-3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-methoxyphenyl)acetamide (PubChem CID 98191611) has the molecular formula C22H18F6N2O4S2 and a molecular weight of 552.52 g/mol. Its IUPAC name is N-[(3aS,6aR)-3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[(3aS,6aR)-3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 98191611 |
| Molecular Formula | C22H18F6N2O4S2 |
| Molecular Weight | 552.52 g/mol |
| Exact Mass | 552.06 |
| IUPAC Name | N-[(3aS,6aR)-3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)/N=C2\S[C@H]3CS(=O)(=O)C[C@@H]3N2c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C22H18F6N2O4S2/c1-34-16-4-2-12(3-5-16)6-19(31)29-20-30(17-10-36(32,33)11-18(17)35-20)15-8-13(21(23,24)25)7-14(9-15)22(26,27)28/h2-5,7-9,17-18H,6,10-11H2,1H3/b29-20-/t17-,18-/m0/s1 |
| InChIKey | BCSWIOCVTWPVTG-XXQNEAGCSA-N |
| XLogP | 4.58 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|