C17H16F6N2O3S2 — CID 27308080
N-[(3aR,6aR)-3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]butanamide (PubChem CID 27308080) has the molecular formula C17H16F6N2O3S2 and a molecular weight of 474.45 g/mol. Its IUPAC name is N-[(3aR,6aR)-3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]butanamide.
| Compound Name | N-[(3aR,6aR)-3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]butanamide |
|---|---|
| PubChem CID | 27308080 |
| Molecular Formula | C17H16F6N2O3S2 |
| Molecular Weight | 474.45 g/mol |
| Exact Mass | 474.05 |
| IUPAC Name | N-[(3aR,6aR)-3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]butanamide |
| SMILES | CCCC(=O)/N=C1\S[C@H]2CS(=O)(=O)C[C@H]2N1c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H16F6N2O3S2/c1-2-3-14(26)24-15-25(12-7-30(27,28)8-13(12)29-15)11-5-9(16(18,19)20)4-10(6-11)17(21,22)23/h4-6,12-13H,2-3,7-8H2,1H3/b24-15-/t12-,13+/m1/s1 |
| InChIKey | SMFGWBYNFZKOLP-XANWUDDXSA-N |
| XLogP | 4.13 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|