C21H18ClF3N2O3S2 — CID 39882750
N-[(3aS,6aR)-3-[4-chloro-3-(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-phenylpropanamide (PubChem CID 39882750) has the molecular formula C21H18ClF3N2O3S2 and a molecular weight of 502.97 g/mol. Its IUPAC name is N-[(3aS,6aR)-3-[4-chloro-3-(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-phenylpropanamide.
| Compound Name | N-[(3aS,6aR)-3-[4-chloro-3-(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-phenylpropanamide |
|---|---|
| PubChem CID | 39882750 |
| Molecular Formula | C21H18ClF3N2O3S2 |
| Molecular Weight | 502.97 g/mol |
| Exact Mass | 502.04 |
| IUPAC Name | N-[(3aS,6aR)-3-[4-chloro-3-(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)/N=C1\S[C@H]2CS(=O)(=O)C[C@@H]2N1c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H18ClF3N2O3S2/c22-16-8-7-14(10-15(16)21(23,24)25)27-17-11-32(29,30)12-18(17)31-20(27)26-19(28)9-6-13-4-2-1-3-5-13/h1-5,7-8,10,17-18H,6,9,11-12H2/b26-20-/t17-,18-/m0/s1 |
| InChIKey | NMQBRPAKLKMIRC-WAUMPOFPSA-N |
| XLogP | 4.59 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.97 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|