C16H14ClF3N2O5S2 — CID 39741389
4-[[(3aR,6aR)-3-[4-chloro-3-(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-4-oxobutanoic acid (PubChem CID 39741389) has the molecular formula C16H14ClF3N2O5S2 and a molecular weight of 470.88 g/mol. Its IUPAC name is 4-[[(3aR,6aR)-3-[4-chloro-3-(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[(3aR,6aR)-3-[4-chloro-3-(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 39741389 |
| Molecular Formula | C16H14ClF3N2O5S2 |
| Molecular Weight | 470.88 g/mol |
| Exact Mass | 470.00 |
| IUPAC Name | 4-[[(3aR,6aR)-3-[4-chloro-3-(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)/N=C1\S[C@H]2CS(=O)(=O)C[C@H]2N1c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H14ClF3N2O5S2/c17-10-2-1-8(5-9(10)16(18,19)20)22-11-6-29(26,27)7-12(11)28-15(22)21-13(23)3-4-14(24)25/h1-2,5,11-12H,3-4,6-7H2,(H,24,25)/b21-15-/t11-,12+/m1/s1 |
| InChIKey | YUKNWTBUTJQVCX-BFXUUKRPSA-N |
| XLogP | 2.83 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.88 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|