C22H24N4O6S — CID 3989692
3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-1-(2-morpholin-4-ium-4-ylethyl)-2-(3-nitrophenyl)-5-oxo-2H-pyrrol-4-olate (PubChem CID 3989692) has the molecular formula C22H24N4O6S and a molecular weight of 472.52 g/mol. Its IUPAC name is 3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-1-(2-morpholin-4-ium-4-ylethyl)-2-(3-nitrophenyl)-5-oxo-2H-pyrrol-4-olate.
| Compound Name | 3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-1-(2-morpholin-4-ium-4-ylethyl)-2-(3-nitrophenyl)-5-oxo-2H-pyrrol-4-olate |
|---|---|
| PubChem CID | 3989692 |
| Molecular Formula | C22H24N4O6S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-1-(2-morpholin-4-ium-4-ylethyl)-2-(3-nitrophenyl)-5-oxo-2H-pyrrol-4-olate |
| SMILES | Cc1nc(C)c(C(=O)C2=C([O-])C(=O)N(CC[NH+]3CCOCC3)C2c2cccc([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C22H24N4O6S/c1-13-21(33-14(2)23-13)19(27)17-18(15-4-3-5-16(12-15)26(30)31)25(22(29)20(17)28)7-6-24-8-10-32-11-9-24/h3-5,12,18,28H,6-11H2,1-2H3 |
| InChIKey | PTUSBBKVSQUNBT-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 130.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|