C24H30N2O2S — CID 3989718
N-benzyl-2-[2-(cyclooctylamino)-2-oxoethyl]sulfanylbenzamide (PubChem CID 3989718) has the molecular formula C24H30N2O2S and a molecular weight of 410.58 g/mol. Its IUPAC name is N-benzyl-2-[2-(cyclooctylamino)-2-oxoethyl]sulfanylbenzamide.
| Compound Name | N-benzyl-2-[2-(cyclooctylamino)-2-oxoethyl]sulfanylbenzamide |
|---|---|
| PubChem CID | 3989718 |
| Molecular Formula | C24H30N2O2S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | N-benzyl-2-[2-(cyclooctylamino)-2-oxoethyl]sulfanylbenzamide |
| SMILES | O=C(CSc1ccccc1C(=O)NCc1ccccc1)NC1CCCCCCC1 |
| InChI | InChI=1S/C24H30N2O2S/c27-23(26-20-13-7-2-1-3-8-14-20)18-29-22-16-10-9-15-21(22)24(28)25-17-19-11-5-4-6-12-19/h4-6,9-12,15-16,20H,1-3,7-8,13-14,17-18H2,(H,25,28)(H,26,27) |
| InChIKey | LBOUHRIONKHUNE-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |