C23H26N4O4S — CID 3990387
2-[5-[2-(2-methoxyphenoxy)ethylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]-N-(2-methoxyphenyl)acetamide (PubChem CID 3990387) has the molecular formula C23H26N4O4S and a molecular weight of 454.55 g/mol. Its IUPAC name is 2-[5-[2-(2-methoxyphenoxy)ethylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[5-[2-(2-methoxyphenoxy)ethylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 3990387 |
| Molecular Formula | C23H26N4O4S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 2-[5-[2-(2-methoxyphenoxy)ethylsulfanyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]-N-(2-methoxyphenyl)acetamide |
| SMILES | C=CCn1c(CC(=O)Nc2ccccc2OC)nnc1SCCOc1ccccc1OC |
| InChI | InChI=1S/C23H26N4O4S/c1-4-13-27-21(16-22(28)24-17-9-5-6-10-18(17)29-2)25-26-23(27)32-15-14-31-20-12-8-7-11-19(20)30-3/h4-12H,1,13-16H2,2-3H3,(H,24,28) |
| InChIKey | URKXKWBCOLTXLB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|