C19H24BrN3O2S — CID 39912279
2-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-N-[(2-methoxyphenyl)methyl]acetamide (PubChem CID 39912279) has the molecular formula C19H24BrN3O2S and a molecular weight of 438.39 g/mol. Its IUPAC name is 2-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-N-[(2-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-N-[(2-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 39912279 |
| Molecular Formula | C19H24BrN3O2S |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 2-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-N-[(2-methoxyphenyl)methyl]acetamide |
| SMILES | COc1ccccc1CNC(=O)CN1CCN(Cc2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C19H24BrN3O2S/c1-25-17-5-3-2-4-15(17)12-21-19(24)14-23-10-8-22(9-11-23)13-16-6-7-18(20)26-16/h2-7H,8-14H2,1H3,(H,21,24) |
| InChIKey | GGYYXOJLXCWOIV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |