C19H23BrFN3O2S — CID 55831285
2-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-N-[2-(4-fluorophenoxy)ethyl]acetamide (PubChem CID 55831285) has the molecular formula C19H23BrFN3O2S and a molecular weight of 456.38 g/mol. Its IUPAC name is 2-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-N-[2-(4-fluorophenoxy)ethyl]acetamide.
| Compound Name | 2-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-N-[2-(4-fluorophenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 55831285 |
| Molecular Formula | C19H23BrFN3O2S |
| Molecular Weight | 456.38 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | 2-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]-N-[2-(4-fluorophenoxy)ethyl]acetamide |
| SMILES | O=C(CN1CCN(Cc2ccc(Br)s2)CC1)NCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C19H23BrFN3O2S/c20-18-6-5-17(27-18)13-23-8-10-24(11-9-23)14-19(25)22-7-12-26-16-3-1-15(21)2-4-16/h1-6H,7-14H2,(H,22,25) |
| InChIKey | JUVJRYYPCKKEPZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|