C14H19FN2O4S — CID 60506751
2-(1,1-dioxo-1,4-thiazinan-4-yl)-N-[2-(4-fluorophenoxy)ethyl]acetamide (PubChem CID 60506751) has the molecular formula C14H19FN2O4S and a molecular weight of 330.38 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-4-yl)-N-[2-(4-fluorophenoxy)ethyl]acetamide.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-N-[2-(4-fluorophenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 60506751 |
| Molecular Formula | C14H19FN2O4S |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-N-[2-(4-fluorophenoxy)ethyl]acetamide |
| SMILES | O=C(CN1CCS(=O)(=O)CC1)NCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C14H19FN2O4S/c15-12-1-3-13(4-2-12)21-8-5-16-14(18)11-17-6-9-22(19,20)10-7-17/h1-4H,5-11H2,(H,16,18) |
| InChIKey | ZHQJCXPESUWWHW-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|