C20H20N4O3S2 — CID 3994544
2-[(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]-N-(2-nitrophenyl)propanamide (PubChem CID 3994544) has the molecular formula C20H20N4O3S2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 2-[(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]-N-(2-nitrophenyl)propanamide.
| Compound Name | 2-[(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]-N-(2-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 3994544 |
| Molecular Formula | C20H20N4O3S2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 2-[(2-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]-N-(2-nitrophenyl)propanamide |
| SMILES | Cc1nc(SC(C)C(=O)Nc2ccccc2[N+](=O)[O-])c2c3c(sc2n1)CCCC3 |
| InChI | InChI=1S/C20H20N4O3S2/c1-11(18(25)23-14-8-4-5-9-15(14)24(26)27)28-19-17-13-7-3-6-10-16(13)29-20(17)22-12(2)21-19/h4-5,8-9,11H,3,6-7,10H2,1-2H3,(H,23,25) |
| InChIKey | HYKGWHUSBJILDT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|