C31H39ClFN3O3 — CID 3996052
N-[2-[benzyl-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-3-chloro-N-(3-ethoxypropyl)-2,2-dimethylpropanamide (PubChem CID 3996052) has the molecular formula C31H39ClFN3O3 and a molecular weight of 556.12 g/mol. Its IUPAC name is N-[2-[benzyl-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-3-chloro-N-(3-ethoxypropyl)-2,2-dimethylpropanamide.
| Compound Name | N-[2-[benzyl-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-3-chloro-N-(3-ethoxypropyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 3996052 |
| Molecular Formula | C31H39ClFN3O3 |
| Molecular Weight | 556.12 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | N-[2-[benzyl-[[1-[(4-fluorophenyl)methyl]pyrrol-2-yl]methyl]amino]-2-oxoethyl]-3-chloro-N-(3-ethoxypropyl)-2,2-dimethylpropanamide |
| SMILES | CCOCCCN(CC(=O)N(Cc1ccccc1)Cc1cccn1Cc1ccc(F)cc1)C(=O)C(C)(C)CCl |
| InChI | InChI=1S/C31H39ClFN3O3/c1-4-39-19-9-18-35(30(38)31(2,3)24-32)23-29(37)36(21-25-10-6-5-7-11-25)22-28-12-8-17-34(28)20-26-13-15-27(33)16-14-26/h5-8,10-17H,4,9,18-24H2,1-3H3 |
| InChIKey | RHFCTIXYUGKVDE-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.12 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|