C19H15ClN2O5S — CID 39968721
(12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methyl 5-chloro-2,3-dihydro-1,4-benzodioxine-7-carboxylate (PubChem CID 39968721) has the molecular formula C19H15ClN2O5S and a molecular weight of 418.86 g/mol. Its IUPAC name is (12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methyl 5-chloro-2,3-dihydro-1,4-benzodioxine-7-carboxylate.
| Compound Name | (12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methyl 5-chloro-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
|---|---|
| PubChem CID | 39968721 |
| Molecular Formula | C19H15ClN2O5S |
| Molecular Weight | 418.86 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | (12-oxo-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-10-yl)methyl 5-chloro-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
| SMILES | O=C(OCc1nc2sc3c(c2c(=O)[nH]1)CCC3)c1cc(Cl)c2c(c1)OCCO2 |
| InChI | InChI=1S/C19H15ClN2O5S/c20-11-6-9(7-12-16(11)26-5-4-25-12)19(24)27-8-14-21-17(23)15-10-2-1-3-13(10)28-18(15)22-14/h6-7H,1-5,8H2,(H,21,22,23) |
| InChIKey | OOLDIUUHPPLVPO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 90.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.86 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |