C26H26N4O4S — CID 39969798
4-[[(4-acetylphenyl)sulfonylamino]methyl]-N-[(1-ethylbenzimidazol-2-yl)methyl]benzamide (PubChem CID 39969798) has the molecular formula C26H26N4O4S and a molecular weight of 490.59 g/mol. Its IUPAC name is 4-[[(4-acetylphenyl)sulfonylamino]methyl]-N-[(1-ethylbenzimidazol-2-yl)methyl]benzamide.
| Compound Name | 4-[[(4-acetylphenyl)sulfonylamino]methyl]-N-[(1-ethylbenzimidazol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 39969798 |
| Molecular Formula | C26H26N4O4S |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 4-[[(4-acetylphenyl)sulfonylamino]methyl]-N-[(1-ethylbenzimidazol-2-yl)methyl]benzamide |
| SMILES | CCn1c(CNC(=O)c2ccc(CNS(=O)(=O)c3ccc(C(C)=O)cc3)cc2)nc2ccccc21 |
| InChI | InChI=1S/C26H26N4O4S/c1-3-30-24-7-5-4-6-23(24)29-25(30)17-27-26(32)21-10-8-19(9-11-21)16-28-35(33,34)22-14-12-20(13-15-22)18(2)31/h4-15,28H,3,16-17H2,1-2H3,(H,27,32) |
| InChIKey | MWPARIXPLBMLPX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |