C15H13F2N3O3 — CID 39985138
4-[(3,4-difluorophenyl)methyl-methylamino]-3-nitrobenzamide (PubChem CID 39985138) has the molecular formula C15H13F2N3O3 and a molecular weight of 321.28 g/mol. Its IUPAC name is 4-[(3,4-difluorophenyl)methyl-methylamino]-3-nitrobenzamide.
| Compound Name | 4-[(3,4-difluorophenyl)methyl-methylamino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 39985138 |
| Molecular Formula | C15H13F2N3O3 |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 4-[(3,4-difluorophenyl)methyl-methylamino]-3-nitrobenzamide |
| SMILES | CN(Cc1ccc(F)c(F)c1)c1ccc(C(N)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13F2N3O3/c1-19(8-9-2-4-11(16)12(17)6-9)13-5-3-10(15(18)21)7-14(13)20(22)23/h2-7H,8H2,1H3,(H2,18,21) |
| InChIKey | UWEPHWQWYCOEDV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|