C22H28N6O2S — CID 39985665
1-[(1R)-1-(3-butyl-1,2,4-oxadiazol-5-yl)ethyl]sulfanyl-4-pentyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 39985665) has the molecular formula C22H28N6O2S and a molecular weight of 440.57 g/mol. Its IUPAC name is 1-[(1R)-1-(3-butyl-1,2,4-oxadiazol-5-yl)ethyl]sulfanyl-4-pentyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 1-[(1R)-1-(3-butyl-1,2,4-oxadiazol-5-yl)ethyl]sulfanyl-4-pentyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 39985665 |
| Molecular Formula | C22H28N6O2S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 1-[(1R)-1-(3-butyl-1,2,4-oxadiazol-5-yl)ethyl]sulfanyl-4-pentyl-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | CCCCCn1c(=O)c2ccccc2n2c(S[C@H](C)c3nc(CCCC)no3)nnc12 |
| InChI | InChI=1S/C22H28N6O2S/c1-4-6-10-14-27-20(29)16-11-8-9-12-17(16)28-21(27)24-25-22(28)31-15(3)19-23-18(26-30-19)13-7-5-2/h8-9,11-12,15H,4-7,10,13-14H2,1-3H3/t15-/m1/s1 |
| InChIKey | PFDVEIMCEDNOCE-OAHLLOKOSA-N |
| XLogP | 4.81 |
| TPSA | 91.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|