C17H20ClN3O3 — CID 39998866
2-(3-chloro-2-morpholin-4-ylanilino)-N-(furan-2-ylmethyl)acetamide (PubChem CID 39998866) has the molecular formula C17H20ClN3O3 and a molecular weight of 349.82 g/mol. Its IUPAC name is 2-(3-chloro-2-morpholin-4-ylanilino)-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-(3-chloro-2-morpholin-4-ylanilino)-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 39998866 |
| Molecular Formula | C17H20ClN3O3 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 2-(3-chloro-2-morpholin-4-ylanilino)-N-(furan-2-ylmethyl)acetamide |
| SMILES | O=C(CNc1cccc(Cl)c1N1CCOCC1)NCc1ccco1 |
| InChI | InChI=1S/C17H20ClN3O3/c18-14-4-1-5-15(17(14)21-6-9-23-10-7-21)19-12-16(22)20-11-13-3-2-8-24-13/h1-5,8,19H,6-7,9-12H2,(H,20,22) |
| InChIKey | ZMJKLZMJGMAMGH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |