C24H19ClN2O8 — CID 4001598
[1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 4-(4-chloro-2-nitrophenoxy)benzoate (PubChem CID 4001598) has the molecular formula C24H19ClN2O8 and a molecular weight of 498.88 g/mol. Its IUPAC name is [1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 4-(4-chloro-2-nitrophenoxy)benzoate.
| Compound Name | [1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 4-(4-chloro-2-nitrophenoxy)benzoate |
|---|---|
| PubChem CID | 4001598 |
| Molecular Formula | C24H19ClN2O8 |
| Molecular Weight | 498.88 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | [1-(1,3-benzodioxol-5-ylmethylamino)-1-oxopropan-2-yl] 4-(4-chloro-2-nitrophenoxy)benzoate |
| SMILES | CC(OC(=O)c1ccc(Oc2ccc(Cl)cc2[N+](=O)[O-])cc1)C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H19ClN2O8/c1-14(23(28)26-12-15-2-8-21-22(10-15)33-13-32-21)34-24(29)16-3-6-18(7-4-16)35-20-9-5-17(25)11-19(20)27(30)31/h2-11,14H,12-13H2,1H3,(H,26,28) |
| InChIKey | BWRXCFFHCZRSLV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.88 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|