C35H40N4O5 — CID 4003806
3-(3,5-dimethoxyphenyl)-N,N-dimethyl-2-[4-[3-methyl-4-[3-oxo-3-(propan-2-ylamino)propyl]-1-phenylpyrazol-5-yl]oxyphenyl]prop-2-enamide (PubChem CID 4003806) has the molecular formula C35H40N4O5 and a molecular weight of 596.73 g/mol. Its IUPAC name is 3-(3,5-dimethoxyphenyl)-N,N-dimethyl-2-[4-[3-methyl-4-[3-oxo-3-(propan-2-ylamino)propyl]-1-phenylpyrazol-5-yl]oxyphenyl]prop-2-enamide.
| Compound Name | 3-(3,5-dimethoxyphenyl)-N,N-dimethyl-2-[4-[3-methyl-4-[3-oxo-3-(propan-2-ylamino)propyl]-1-phenylpyrazol-5-yl]oxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 4003806 |
| Molecular Formula | C35H40N4O5 |
| Molecular Weight | 596.73 g/mol |
| Exact Mass | 596.30 |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-N,N-dimethyl-2-[4-[3-methyl-4-[3-oxo-3-(propan-2-ylamino)propyl]-1-phenylpyrazol-5-yl]oxyphenyl]prop-2-enamide |
| SMILES | COc1cc(C=C(C(=O)N(C)C)c2ccc(Oc3c(CCC(=O)NC(C)C)c(C)nn3-c3ccccc3)cc2)cc(OC)c1 |
| InChI | InChI=1S/C35H40N4O5/c1-23(2)36-33(40)18-17-31-24(3)37-39(27-11-9-8-10-12-27)35(31)44-28-15-13-26(14-16-28)32(34(41)38(4)5)21-25-19-29(42-6)22-30(20-25)43-7/h8-16,19-23H,17-18H2,1-7H3,(H,36,40) |
| InChIKey | HOHCXSMZKIQRHL-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.73 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|