About 1-(2,4-dihydroxy-5-pentylphenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethanone
1-(2,4-dihydroxy-5-pentylphenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethanone (PubChem CID 4005972) has the molecular formula C17H21NO3S
and a molecular weight of 319.43 g/mol. Its IUPAC name is 1-(2,4-dihydroxy-5-pentylphenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethanone.
Molecular Properties
| Compound Name | 1-(2,4-dihydroxy-5-pentylphenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethanone |
| PubChem CID | 4005972 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 1-(2,4-dihydroxy-5-pentylphenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethanone |
| SMILES | CCCCCc1cc(C(=O)Cc2nc(C)cs2)c(O)cc1O |
| InChI | InChI=1S/C17H21NO3S/c1-3-4-5-6-12-7-13(15(20)8-14(12)19)16(21)9-17-18-11(2)10-22-17/h7-8,10,19-20H,3-6,9H2,1-2H3 |
| InChIKey | NYTRGUAOIVDYFZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,4-dihydroxy-5-pentylphenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-dihydroxy-5-pentylphenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethanone?
The IUPAC name of 1-(2,4-dihydroxy-5-pentylphenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethanone (CID 4005972) is 1-(2,4-dihydroxy-5-pentylphenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethanone.
What is the SMILES notation for 1-(2,4-dihydroxy-5-pentylphenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethanone?
The canonical SMILES for 1-(2,4-dihydroxy-5-pentylphenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethanone is CCCCCc1cc(C(=O)Cc2nc(C)cs2)c(O)cc1O.
What is the InChIKey of 1-(2,4-dihydroxy-5-pentylphenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethanone?
The InChIKey is NYTRGUAOIVDYFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO3S/c1-3-4-5-6-12-7-13(15(20)8-14(12)19)16(21)9-17-18-11(2)10-22-17/h7-8,10,19-20H,3-6,9H2,1-2H3.
What are the key properties of 1-(2,4-dihydroxy-5-pentylphenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethanone?
1-(2,4-dihydroxy-5-pentylphenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethanone has a molecular weight of 319.43 g/mol, XLogP of 4.02, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-dihydroxy-5-pentylphenyl)-2-(4-methyl-1,3-thiazol-2-yl)ethanone is sourced from PubChem (CID 4005972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).