C22H23NO7S — CID 4009555
[2-[(3-methoxycarbonyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)amino]-2-oxoethyl] 2,3-dihydro-1,4-benzodioxine-3-carboxylate (PubChem CID 4009555) has the molecular formula C22H23NO7S and a molecular weight of 445.49 g/mol. Its IUPAC name is [2-[(3-methoxycarbonyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)amino]-2-oxoethyl] 2,3-dihydro-1,4-benzodioxine-3-carboxylate.
| Compound Name | [2-[(3-methoxycarbonyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)amino]-2-oxoethyl] 2,3-dihydro-1,4-benzodioxine-3-carboxylate |
|---|---|
| PubChem CID | 4009555 |
| Molecular Formula | C22H23NO7S |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | [2-[(3-methoxycarbonyl-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)amino]-2-oxoethyl] 2,3-dihydro-1,4-benzodioxine-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)COC(=O)C2COc3ccccc3O2)sc2c1CCCCC2 |
| InChI | InChI=1S/C22H23NO7S/c1-27-22(26)19-13-7-3-2-4-10-17(13)31-20(19)23-18(24)12-29-21(25)16-11-28-14-8-5-6-9-15(14)30-16/h5-6,8-9,16H,2-4,7,10-12H2,1H3,(H,23,24) |
| InChIKey | BFTMSYGDJSEQMW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |