C19H22FNO3S — CID 4012387
1-[(3-fluoro-4-methoxyphenyl)-(5-methylthiophen-2-yl)methyl]piperidine-4-carboxylic acid (PubChem CID 4012387) has the molecular formula C19H22FNO3S and a molecular weight of 363.45 g/mol. Its IUPAC name is 1-[(3-fluoro-4-methoxyphenyl)-(5-methylthiophen-2-yl)methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(3-fluoro-4-methoxyphenyl)-(5-methylthiophen-2-yl)methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 4012387 |
| Molecular Formula | C19H22FNO3S |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 1-[(3-fluoro-4-methoxyphenyl)-(5-methylthiophen-2-yl)methyl]piperidine-4-carboxylic acid |
| SMILES | COc1ccc(C(c2ccc(C)s2)N2CCC(C(=O)O)CC2)cc1F |
| InChI | InChI=1S/C19H22FNO3S/c1-12-3-6-17(25-12)18(14-4-5-16(24-2)15(20)11-14)21-9-7-13(8-10-21)19(22)23/h3-6,11,13,18H,7-10H2,1-2H3,(H,22,23) |
| InChIKey | JYOZHGBJEBHRIE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |