C17H21FN2OS — CID 3435516
1-[(3-fluoro-4-methoxyphenyl)-(5-methylthiophen-2-yl)methyl]piperazine (PubChem CID 3435516) has the molecular formula C17H21FN2OS and a molecular weight of 320.43 g/mol. Its IUPAC name is 1-[(3-fluoro-4-methoxyphenyl)-(5-methylthiophen-2-yl)methyl]piperazine.
| Compound Name | 1-[(3-fluoro-4-methoxyphenyl)-(5-methylthiophen-2-yl)methyl]piperazine |
|---|---|
| PubChem CID | 3435516 |
| Molecular Formula | C17H21FN2OS |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 1-[(3-fluoro-4-methoxyphenyl)-(5-methylthiophen-2-yl)methyl]piperazine |
| SMILES | COc1ccc(C(c2ccc(C)s2)N2CCNCC2)cc1F |
| InChI | InChI=1S/C17H21FN2OS/c1-12-3-6-16(22-12)17(20-9-7-19-8-10-20)13-4-5-15(21-2)14(18)11-13/h3-6,11,17,19H,7-10H2,1-2H3 |
| InChIKey | WFEMFWJUBIWYDE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |