C19H20ClNO3 — CID 4014042
6-(3-chloro-2-methoxy-5-methylphenyl)-2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]isoquinoline (PubChem CID 4014042) has the molecular formula C19H20ClNO3 and a molecular weight of 345.83 g/mol. Its IUPAC name is 6-(3-chloro-2-methoxy-5-methylphenyl)-2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]isoquinoline.
| Compound Name | 6-(3-chloro-2-methoxy-5-methylphenyl)-2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]isoquinoline |
|---|---|
| PubChem CID | 4014042 |
| Molecular Formula | C19H20ClNO3 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 6-(3-chloro-2-methoxy-5-methylphenyl)-2,3,6,7,8,9-hexahydro-[1,4]dioxino[2,3-g]isoquinoline |
| SMILES | COc1c(Cl)cc(C)cc1C1NCCc2cc3c(cc21)OCCO3 |
| InChI | InChI=1S/C19H20ClNO3/c1-11-7-14(19(22-2)15(20)8-11)18-13-10-17-16(23-5-6-24-17)9-12(13)3-4-21-18/h7-10,18,21H,3-6H2,1-2H3 |
| InChIKey | VUVKCPANXSWAFW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |