C18H19N3O3 — CID 4014223
2-(3,4-dimethylphenyl)-N-[1-(3-nitrophenyl)ethylideneamino]acetamide (PubChem CID 4014223) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-N-[1-(3-nitrophenyl)ethylideneamino]acetamide.
| Compound Name | 2-(3,4-dimethylphenyl)-N-[1-(3-nitrophenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 4014223 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-N-[1-(3-nitrophenyl)ethylideneamino]acetamide |
| SMILES | CC(=NNC(=O)Cc1ccc(C)c(C)c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H19N3O3/c1-12-7-8-15(9-13(12)2)10-18(22)20-19-14(3)16-5-4-6-17(11-16)21(23)24/h4-9,11H,10H2,1-3H3,(H,20,22) |
| InChIKey | XGDYZKMRQVBSBK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|