C20H17BrFNO2 — CID 4014685
2-bromo-N-[(4-fluorophenyl)methyl]-N-[(5-methylfuran-2-yl)methyl]benzamide (PubChem CID 4014685) has the molecular formula C20H17BrFNO2 and a molecular weight of 402.26 g/mol. Its IUPAC name is 2-bromo-N-[(4-fluorophenyl)methyl]-N-[(5-methylfuran-2-yl)methyl]benzamide.
| Compound Name | 2-bromo-N-[(4-fluorophenyl)methyl]-N-[(5-methylfuran-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 4014685 |
| Molecular Formula | C20H17BrFNO2 |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 2-bromo-N-[(4-fluorophenyl)methyl]-N-[(5-methylfuran-2-yl)methyl]benzamide |
| SMILES | Cc1ccc(CN(Cc2ccc(F)cc2)C(=O)c2ccccc2Br)o1 |
| InChI | InChI=1S/C20H17BrFNO2/c1-14-6-11-17(25-14)13-23(12-15-7-9-16(22)10-8-15)20(24)18-4-2-3-5-19(18)21/h2-11H,12-13H2,1H3 |
| InChIKey | XVQZHCOUERZJRG-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |