C16H22ClNO3 — CID 4015616
1-[(5-chloro-2-ethoxy-3-methylphenyl)methyl]piperidine-4-carboxylic acid (PubChem CID 4015616) has the molecular formula C16H22ClNO3 and a molecular weight of 311.81 g/mol. Its IUPAC name is 1-[(5-chloro-2-ethoxy-3-methylphenyl)methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(5-chloro-2-ethoxy-3-methylphenyl)methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 4015616 |
| Molecular Formula | C16H22ClNO3 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 1-[(5-chloro-2-ethoxy-3-methylphenyl)methyl]piperidine-4-carboxylic acid |
| SMILES | CCOc1c(C)cc(Cl)cc1CN1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C16H22ClNO3/c1-3-21-15-11(2)8-14(17)9-13(15)10-18-6-4-12(5-7-18)16(19)20/h8-9,12H,3-7,10H2,1-2H3,(H,19,20) |
| InChIKey | FIIRQRRSODGTHQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |