C21H24ClNO3 — CID 4001702
1-[(5-chloro-4-methyl-2-phenylmethoxyphenyl)methyl]piperidine-4-carboxylic acid (PubChem CID 4001702) has the molecular formula C21H24ClNO3 and a molecular weight of 373.88 g/mol. Its IUPAC name is 1-[(5-chloro-4-methyl-2-phenylmethoxyphenyl)methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(5-chloro-4-methyl-2-phenylmethoxyphenyl)methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 4001702 |
| Molecular Formula | C21H24ClNO3 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 1-[(5-chloro-4-methyl-2-phenylmethoxyphenyl)methyl]piperidine-4-carboxylic acid |
| SMILES | Cc1cc(OCc2ccccc2)c(CN2CCC(C(=O)O)CC2)cc1Cl |
| InChI | InChI=1S/C21H24ClNO3/c1-15-11-20(26-14-16-5-3-2-4-6-16)18(12-19(15)22)13-23-9-7-17(8-10-23)21(24)25/h2-6,11-12,17H,7-10,13-14H2,1H3,(H,24,25) |
| InChIKey | XTNLXHKBKACFBS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |