C25H31ClN2O2 — CID 110160324
1-[(5aR,9aR)-7-[(5-chloro-2-phenylmethoxyphenyl)methyl]-3,4,5,5a,6,8,9,9a-octahydro-2H-pyrido[4,3-b]azepin-1-yl]ethanone (PubChem CID 110160324) has the molecular formula C25H31ClN2O2 and a molecular weight of 426.99 g/mol. Its IUPAC name is 1-[(5aR,9aR)-7-[(5-chloro-2-phenylmethoxyphenyl)methyl]-3,4,5,5a,6,8,9,9a-octahydro-2H-pyrido[4,3-b]azepin-1-yl]ethanone.
| Compound Name | 1-[(5aR,9aR)-7-[(5-chloro-2-phenylmethoxyphenyl)methyl]-3,4,5,5a,6,8,9,9a-octahydro-2H-pyrido[4,3-b]azepin-1-yl]ethanone |
|---|---|
| PubChem CID | 110160324 |
| Molecular Formula | C25H31ClN2O2 |
| Molecular Weight | 426.99 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 1-[(5aR,9aR)-7-[(5-chloro-2-phenylmethoxyphenyl)methyl]-3,4,5,5a,6,8,9,9a-octahydro-2H-pyrido[4,3-b]azepin-1-yl]ethanone |
| SMILES | CC(=O)N1CCCC[C@@H]2CN(Cc3cc(Cl)ccc3OCc3ccccc3)CC[C@H]21 |
| InChI | InChI=1S/C25H31ClN2O2/c1-19(29)28-13-6-5-9-21-16-27(14-12-24(21)28)17-22-15-23(26)10-11-25(22)30-18-20-7-3-2-4-8-20/h2-4,7-8,10-11,15,21,24H,5-6,9,12-14,16-18H2,1H3/t21-,24-/m1/s1 |
| InChIKey | BGRCWYZGDNWFRR-ZJSXRUAMSA-N |
| XLogP | 5.14 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.99 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |