About 3-[3,5-bis(phenylmethoxy)phenyl]-1H-pyrazole-5-carboxylic acid
3-[3,5-bis(phenylmethoxy)phenyl]-1H-pyrazole-5-carboxylic acid (PubChem CID 4017523) has the molecular formula C24H20N2O4
and a molecular weight of 400.43 g/mol. Its IUPAC name is 3-[3,5-bis(phenylmethoxy)phenyl]-1H-pyrazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 3-[3,5-bis(phenylmethoxy)phenyl]-1H-pyrazole-5-carboxylic acid |
| PubChem CID | 4017523 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 3-[3,5-bis(phenylmethoxy)phenyl]-1H-pyrazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cc(OCc3ccccc3)cc(OCc3ccccc3)c2)n[nH]1 |
| InChI | InChI=1S/C24H20N2O4/c27-24(28)23-14-22(25-26-23)19-11-20(29-15-17-7-3-1-4-8-17)13-21(12-19)30-16-18-9-5-2-6-10-18/h1-14H,15-16H2,(H,25,26)(H,27,28) |
| InChIKey | DOTSYUPTCKZEDA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[3,5-bis(phenylmethoxy)phenyl]-1H-pyrazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,5-bis(phenylmethoxy)phenyl]-1H-pyrazole-5-carboxylic acid?
The IUPAC name of 3-[3,5-bis(phenylmethoxy)phenyl]-1H-pyrazole-5-carboxylic acid (CID 4017523) is 3-[3,5-bis(phenylmethoxy)phenyl]-1H-pyrazole-5-carboxylic acid.
What is the SMILES notation for 3-[3,5-bis(phenylmethoxy)phenyl]-1H-pyrazole-5-carboxylic acid?
The canonical SMILES for 3-[3,5-bis(phenylmethoxy)phenyl]-1H-pyrazole-5-carboxylic acid is O=C(O)c1cc(-c2cc(OCc3ccccc3)cc(OCc3ccccc3)c2)n[nH]1.
What is the InChIKey of 3-[3,5-bis(phenylmethoxy)phenyl]-1H-pyrazole-5-carboxylic acid?
The InChIKey is DOTSYUPTCKZEDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20N2O4/c27-24(28)23-14-22(25-26-23)19-11-20(29-15-17-7-3-1-4-8-17)13-21(12-19)30-16-18-9-5-2-6-10-18/h1-14H,15-16H2,(H,25,26)(H,27,28).
What are the key properties of 3-[3,5-bis(phenylmethoxy)phenyl]-1H-pyrazole-5-carboxylic acid?
3-[3,5-bis(phenylmethoxy)phenyl]-1H-pyrazole-5-carboxylic acid has a molecular weight of 400.43 g/mol, XLogP of 4.93, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-bis(phenylmethoxy)phenyl]-1H-pyrazole-5-carboxylic acid is sourced from PubChem (CID 4017523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).