C34H35ClN6O3S — CID 4019967
[4-[[4-(4-benzylpiperidin-1-yl)-6-chloropyrimidin-2-yl]sulfanylmethyl]phenyl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 4019967) has the molecular formula C34H35ClN6O3S and a molecular weight of 643.21 g/mol. Its IUPAC name is [4-[[4-(4-benzylpiperidin-1-yl)-6-chloropyrimidin-2-yl]sulfanylmethyl]phenyl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | [4-[[4-(4-benzylpiperidin-1-yl)-6-chloropyrimidin-2-yl]sulfanylmethyl]phenyl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 4019967 |
| Molecular Formula | C34H35ClN6O3S |
| Molecular Weight | 643.21 g/mol |
| Exact Mass | 642.22 |
| IUPAC Name | [4-[[4-(4-benzylpiperidin-1-yl)-6-chloropyrimidin-2-yl]sulfanylmethyl]phenyl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(CSc2nc(Cl)cc(N3CCC(Cc4ccccc4)CC3)n2)cc1)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C34H35ClN6O3S/c35-31-23-32(39-16-14-26(15-17-39)22-25-4-2-1-3-5-25)37-34(36-31)45-24-27-6-8-28(9-7-27)33(42)40-20-18-38(19-21-40)29-10-12-30(13-11-29)41(43)44/h1-13,23,26H,14-22,24H2 |
| InChIKey | QURWTXHNPRGQJR-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 95.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.21 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|